About furan-3-ylmethanediamine
furan-3-ylmethanediamine (PubChem CID 54545098) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is furan-3-ylmethanediamine.
Molecular Properties
| Compound Name | furan-3-ylmethanediamine |
| PubChem CID | 54545098 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | furan-3-ylmethanediamine |
| SMILES | NC(N)c1ccoc1 |
| InChI | InChI=1S/C5H8N2O/c6-5(7)4-1-2-8-3-4/h1-3,5H,6-7H2 |
| InChIKey | ZFYYKXGADSDUDY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze furan-3-ylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-ylmethanediamine?
The IUPAC name of furan-3-ylmethanediamine (CID 54545098) is furan-3-ylmethanediamine.
What is the SMILES notation for furan-3-ylmethanediamine?
The canonical SMILES for furan-3-ylmethanediamine is NC(N)c1ccoc1.
What is the InChIKey of furan-3-ylmethanediamine?
The InChIKey is ZFYYKXGADSDUDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c6-5(7)4-1-2-8-3-4/h1-3,5H,6-7H2.
What are the key properties of furan-3-ylmethanediamine?
furan-3-ylmethanediamine has a molecular weight of 112.13 g/mol, XLogP of 0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-ylmethanediamine is sourced from PubChem (CID 54545098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).