C7H11NO3 — CID 66204732
2-amino-1-(furan-3-yl)propane-1,3-diol (PubChem CID 66204732) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-amino-1-(furan-3-yl)propane-1,3-diol.
| Compound Name | 2-amino-1-(furan-3-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 66204732 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 2-amino-1-(furan-3-yl)propane-1,3-diol |
| SMILES | NC(CO)C(O)c1ccoc1 |
| InChI | InChI=1S/C7H11NO3/c8-6(3-9)7(10)5-1-2-11-4-5/h1-2,4,6-7,9-10H,3,8H2 |
| InChIKey | FKEIKPZWGCZTAP-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |