C13H14FNO2 — CID 65185271
3-amino-2-(4-fluorophenyl)-1-(furan-3-yl)propan-1-ol (PubChem CID 65185271) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 3-amino-2-(4-fluorophenyl)-1-(furan-3-yl)propan-1-ol.
| Compound Name | 3-amino-2-(4-fluorophenyl)-1-(furan-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 65185271 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-amino-2-(4-fluorophenyl)-1-(furan-3-yl)propan-1-ol |
| SMILES | NCC(c1ccc(F)cc1)C(O)c1ccoc1 |
| InChI | InChI=1S/C13H14FNO2/c14-11-3-1-9(2-4-11)12(7-15)13(16)10-5-6-17-8-10/h1-6,8,12-13,16H,7,15H2 |
| InChIKey | DSGFSYUZMZIBTC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |