C13H13ClFNO2 — CID 65188011
3-amino-2-(2-chloro-4-fluorophenyl)-1-(furan-3-yl)propan-1-ol (PubChem CID 65188011) has the molecular formula C13H13ClFNO2 and a molecular weight of 269.70 g/mol. Its IUPAC name is 3-amino-2-(2-chloro-4-fluorophenyl)-1-(furan-3-yl)propan-1-ol.
| Compound Name | 3-amino-2-(2-chloro-4-fluorophenyl)-1-(furan-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 65188011 |
| Molecular Formula | C13H13ClFNO2 |
| Molecular Weight | 269.70 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 3-amino-2-(2-chloro-4-fluorophenyl)-1-(furan-3-yl)propan-1-ol |
| SMILES | NCC(c1ccc(F)cc1Cl)C(O)c1ccoc1 |
| InChI | InChI=1S/C13H13ClFNO2/c14-12-5-9(15)1-2-10(12)11(6-16)13(17)8-3-4-18-7-8/h1-5,7,11,13,17H,6,16H2 |
| InChIKey | QNRRCUOLVFBUOF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.70 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |