C14H15ClFNOS — CID 65189446
3-amino-2-(2-chloro-4-fluorophenyl)-1-(5-methylthiophen-2-yl)propan-1-ol (PubChem CID 65189446) has the molecular formula C14H15ClFNOS and a molecular weight of 299.80 g/mol. Its IUPAC name is 3-amino-2-(2-chloro-4-fluorophenyl)-1-(5-methylthiophen-2-yl)propan-1-ol.
| Compound Name | 3-amino-2-(2-chloro-4-fluorophenyl)-1-(5-methylthiophen-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 65189446 |
| Molecular Formula | C14H15ClFNOS |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-amino-2-(2-chloro-4-fluorophenyl)-1-(5-methylthiophen-2-yl)propan-1-ol |
| SMILES | Cc1ccc(C(O)C(CN)c2ccc(F)cc2Cl)s1 |
| InChI | InChI=1S/C14H15ClFNOS/c1-8-2-5-13(19-8)14(18)11(7-17)10-4-3-9(16)6-12(10)15/h2-6,11,14,18H,7,17H2,1H3 |
| InChIKey | LVDHNRPVGDCZLT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |