C8H12O3 — CID 129362358
(1S)-1-(furan-3-yl)butane-1,4-diol (PubChem CID 129362358) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (1S)-1-(furan-3-yl)butane-1,4-diol.
| Compound Name | (1S)-1-(furan-3-yl)butane-1,4-diol |
|---|---|
| PubChem CID | 129362358 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (1S)-1-(furan-3-yl)butane-1,4-diol |
| SMILES | OCCC[C@H](O)c1ccoc1 |
| InChI | InChI=1S/C8H12O3/c9-4-1-2-8(10)7-3-5-11-6-7/h3,5-6,8-10H,1-2,4H2/t8-/m0/s1 |
| InChIKey | OTLGPIBBVWUOAZ-QMMMGPOBSA-N |
| XLogP | 1.09 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |