C10H10O3 — CID 83172033
1,2-bis(furan-3-yl)ethanol (PubChem CID 83172033) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 1,2-bis(furan-3-yl)ethanol.
| Compound Name | 1,2-bis(furan-3-yl)ethanol |
|---|---|
| PubChem CID | 83172033 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 1,2-bis(furan-3-yl)ethanol |
| SMILES | OC(Cc1ccoc1)c1ccoc1 |
| InChI | InChI=1S/C10H10O3/c11-10(9-2-4-13-7-9)5-8-1-3-12-6-8/h1-4,6-7,10-11H,5H2 |
| InChIKey | CXSCRYMNPGNNIC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |