C7H10O3 — CID 124583240
(1R)-1-(furan-3-yl)propane-1,3-diol (PubChem CID 124583240) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (1R)-1-(furan-3-yl)propane-1,3-diol.
| Compound Name | (1R)-1-(furan-3-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 124583240 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (1R)-1-(furan-3-yl)propane-1,3-diol |
| SMILES | OCC[C@@H](O)c1ccoc1 |
| InChI | InChI=1S/C7H10O3/c8-3-1-7(9)6-2-4-10-5-6/h2,4-5,7-9H,1,3H2/t7-/m1/s1 |
| InChIKey | SRCFLSHXORAAFT-SSDOTTSWSA-N |
| XLogP | 0.70 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |