C10H13N3O — CID 130518968
(2,3-dimethylimidazol-4-yl)-(furan-3-yl)methanamine (PubChem CID 130518968) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is (2,3-dimethylimidazol-4-yl)-(furan-3-yl)methanamine.
| Compound Name | (2,3-dimethylimidazol-4-yl)-(furan-3-yl)methanamine |
|---|---|
| PubChem CID | 130518968 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (2,3-dimethylimidazol-4-yl)-(furan-3-yl)methanamine |
| SMILES | Cc1ncc(C(N)c2ccoc2)n1C |
| InChI | InChI=1S/C10H13N3O/c1-7-12-5-9(13(7)2)10(11)8-3-4-14-6-8/h3-6,10H,11H2,1-2H3 |
| InChIKey | KLCWMJLQULHVBP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |