C21H19ClFN5O2S — CID 172620811
[3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-5-chloro-2-methoxyphenyl]methanol (PubChem CID 172620811) has the molecular formula C21H19ClFN5O2S and a molecular weight of 459.93 g/mol. Its IUPAC name is [3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-5-chloro-2-methoxyphenyl]methanol.
| Compound Name | [3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-5-chloro-2-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 172620811 |
| Molecular Formula | C21H19ClFN5O2S |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | [3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-5-chloro-2-methoxyphenyl]methanol |
| SMILES | COc1c(CO)cc(Cl)cc1SNc1cccc(-c2nc(C)n3ccnc(N)c23)c1F |
| InChI | InChI=1S/C21H19ClFN5O2S/c1-11-26-18(19-21(24)25-6-7-28(11)19)14-4-3-5-15(17(14)23)27-31-16-9-13(22)8-12(10-29)20(16)30-2/h3-9,27,29H,10H2,1-2H3,(H2,24,25) |
| InChIKey | WCTZFMOXEPTDAB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|