C22H18Cl2FN5O2S — CID 172620889
[3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-2,5-dichlorophenyl]methyl acetate (PubChem CID 172620889) has the molecular formula C22H18Cl2FN5O2S and a molecular weight of 506.39 g/mol. Its IUPAC name is [3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-2,5-dichlorophenyl]methyl acetate.
| Compound Name | [3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-2,5-dichlorophenyl]methyl acetate |
|---|---|
| PubChem CID | 172620889 |
| Molecular Formula | C22H18Cl2FN5O2S |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | [3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-2,5-dichlorophenyl]methyl acetate |
| SMILES | CC(=O)OCc1cc(Cl)cc(SNc2cccc(-c3nc(C)n4ccnc(N)c34)c2F)c1Cl |
| InChI | InChI=1S/C22H18Cl2FN5O2S/c1-11-28-20(21-22(26)27-6-7-30(11)21)15-4-3-5-16(19(15)25)29-33-17-9-14(23)8-13(18(17)24)10-32-12(2)31/h3-9,29H,10H2,1-2H3,(H2,26,27) |
| InChIKey | AHIPCTKQXDGYRO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|