C21H18Cl2FN5OS — CID 172620903
(2,5-dichlorophenyl)methanol;6-fluoro-14-methyl-N-methylsulfanyl-8,10,13,15-tetrazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,9,11,14-heptaen-4-amine (PubChem CID 172620903) has the molecular formula C21H18Cl2FN5OS and a molecular weight of 478.38 g/mol. Its IUPAC name is (2,5-dichlorophenyl)methanol;6-fluoro-14-methyl-N-methylsulfanyl-8,10,13,15-tetrazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,9,11,14-heptaen-4-amine.
| Compound Name | (2,5-dichlorophenyl)methanol;6-fluoro-14-methyl-N-methylsulfanyl-8,10,13,15-tetrazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,9,11,14-heptaen-4-amine |
|---|---|
| PubChem CID | 172620903 |
| Molecular Formula | C21H18Cl2FN5OS |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | (2,5-dichlorophenyl)methanol;6-fluoro-14-methyl-N-methylsulfanyl-8,10,13,15-tetrazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,9,11,14-heptaen-4-amine |
| SMILES | CSNc1cc(F)c2c(c1)-c1nc(C)n3ccnc(c13)N2.OCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H12FN5S.C7H6Cl2O/c1-7-17-12-9-5-8(19-21-2)6-10(15)11(9)18-14-13(12)20(7)4-3-16-14;8-6-1-2-7(9)5(3-6)4-10/h3-6,19H,1-2H3,(H,16,18);1-3,10H,4H2 |
| InChIKey | FHWYITLSTDZXDC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|