C15H13F2NO2S — CID 123333409
N-(2,4-difluoro-3-formylphenyl)-3,5-dimethylbenzenesulfinamide (PubChem CID 123333409) has the molecular formula C15H13F2NO2S and a molecular weight of 309.34 g/mol. Its IUPAC name is N-(2,4-difluoro-3-formylphenyl)-3,5-dimethylbenzenesulfinamide.
| Compound Name | N-(2,4-difluoro-3-formylphenyl)-3,5-dimethylbenzenesulfinamide |
|---|---|
| PubChem CID | 123333409 |
| Molecular Formula | C15H13F2NO2S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-(2,4-difluoro-3-formylphenyl)-3,5-dimethylbenzenesulfinamide |
| SMILES | Cc1cc(C)cc(S(=O)Nc2ccc(F)c(C=O)c2F)c1 |
| InChI | InChI=1S/C15H13F2NO2S/c1-9-5-10(2)7-11(6-9)21(20)18-14-4-3-13(16)12(8-19)15(14)17/h3-8,18H,1-2H3 |
| InChIKey | BDBKUFVAXIWVEW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|