C12H15F2NO3S — CID 87087736
N-(2,4-difluoro-3-formylphenyl)pentane-3-sulfonamide (PubChem CID 87087736) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is N-(2,4-difluoro-3-formylphenyl)pentane-3-sulfonamide.
| Compound Name | N-(2,4-difluoro-3-formylphenyl)pentane-3-sulfonamide |
|---|---|
| PubChem CID | 87087736 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-(2,4-difluoro-3-formylphenyl)pentane-3-sulfonamide |
| SMILES | CCC(CC)S(=O)(=O)Nc1ccc(F)c(C=O)c1F |
| InChI | InChI=1S/C12H15F2NO3S/c1-3-8(4-2)19(17,18)15-11-6-5-10(13)9(7-16)12(11)14/h5-8,15H,3-4H2,1-2H3 |
| InChIKey | AWFJUBBGZHVQBS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|