C8H7F2NO3S — CID 141294322
(2,4-difluoro-3-formylphenyl)methanesulfonamide (PubChem CID 141294322) has the molecular formula C8H7F2NO3S and a molecular weight of 235.21 g/mol. Its IUPAC name is (2,4-difluoro-3-formylphenyl)methanesulfonamide.
| Compound Name | (2,4-difluoro-3-formylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 141294322 |
| Molecular Formula | C8H7F2NO3S |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | (2,4-difluoro-3-formylphenyl)methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc(F)c(C=O)c1F |
| InChI | InChI=1S/C8H7F2NO3S/c9-7-2-1-5(4-15(11,13)14)8(10)6(7)3-12/h1-3H,4H2,(H2,11,13,14) |
| InChIKey | NEVZUGQWEMSMDW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|