C15H8ClF5O2 — CID 155701750
3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-2,6-difluorobenzaldehyde (PubChem CID 155701750) has the molecular formula C15H8ClF5O2 and a molecular weight of 350.67 g/mol. Its IUPAC name is 3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-2,6-difluorobenzaldehyde.
| Compound Name | 3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-2,6-difluorobenzaldehyde |
|---|---|
| PubChem CID | 155701750 |
| Molecular Formula | C15H8ClF5O2 |
| Molecular Weight | 350.67 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-2,6-difluorobenzaldehyde |
| SMILES | O=Cc1c(F)ccc(COc2ccc(C(F)(F)F)cc2Cl)c1F |
| InChI | InChI=1S/C15H8ClF5O2/c16-11-5-9(15(19,20)21)2-4-13(11)23-7-8-1-3-12(17)10(6-22)14(8)18/h1-6H,7H2 |
| InChIKey | NNDUUOILNHYNOQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|