C8H6F2O2 — CID 169274886
2,3-difluoro-6-(hydroxymethyl)benzaldehyde (PubChem CID 169274886) has the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. Its IUPAC name is 2,3-difluoro-6-(hydroxymethyl)benzaldehyde.
| Compound Name | 2,3-difluoro-6-(hydroxymethyl)benzaldehyde |
|---|---|
| PubChem CID | 169274886 |
| Molecular Formula | C8H6F2O2 |
| Molecular Weight | 172.13 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 2,3-difluoro-6-(hydroxymethyl)benzaldehyde |
| SMILES | O=Cc1c(CO)ccc(F)c1F |
| InChI | InChI=1S/C8H6F2O2/c9-7-2-1-5(3-11)6(4-12)8(7)10/h1-2,4,11H,3H2 |
| InChIKey | PTLWGBUXMATRQC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.13 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|