C9H10O3 — CID 87930844
2,6-bis(hydroxymethyl)benzaldehyde (PubChem CID 87930844) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2,6-bis(hydroxymethyl)benzaldehyde.
| Compound Name | 2,6-bis(hydroxymethyl)benzaldehyde |
|---|---|
| PubChem CID | 87930844 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2,6-bis(hydroxymethyl)benzaldehyde |
| SMILES | O=Cc1c(CO)cccc1CO |
| InChI | InChI=1S/C9H10O3/c10-4-7-2-1-3-8(5-11)9(7)6-12/h1-3,6,10-11H,4-5H2 |
| InChIKey | CIFCERGQUDWSOZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|