C12H18F2N2O2S — CID 106017484
N-(2,3-difluorophenyl)-1-(propylamino)propane-2-sulfonamide (PubChem CID 106017484) has the molecular formula C12H18F2N2O2S and a molecular weight of 292.35 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-1-(propylamino)propane-2-sulfonamide.
| Compound Name | N-(2,3-difluorophenyl)-1-(propylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106017484 |
| Molecular Formula | C12H18F2N2O2S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-(2,3-difluorophenyl)-1-(propylamino)propane-2-sulfonamide |
| SMILES | CCCNCC(C)S(=O)(=O)Nc1cccc(F)c1F |
| InChI | InChI=1S/C12H18F2N2O2S/c1-3-7-15-8-9(2)19(17,18)16-11-6-4-5-10(13)12(11)14/h4-6,9,15-16H,3,7-8H2,1-2H3 |
| InChIKey | ZFQYFHYNQRWMLL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|