C12H17F3N2O2S — CID 106056088
1-(propylamino)-N-(2,4,5-trifluorophenyl)propane-2-sulfonamide (PubChem CID 106056088) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 1-(propylamino)-N-(2,4,5-trifluorophenyl)propane-2-sulfonamide.
| Compound Name | 1-(propylamino)-N-(2,4,5-trifluorophenyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106056088 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-(propylamino)-N-(2,4,5-trifluorophenyl)propane-2-sulfonamide |
| SMILES | CCCNCC(C)S(=O)(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H17F3N2O2S/c1-3-4-16-7-8(2)20(18,19)17-12-6-10(14)9(13)5-11(12)15/h5-6,8,16-17H,3-4,7H2,1-2H3 |
| InChIKey | QNXNQJDDYQOTFQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|