C12H18BrClN2O2S — CID 106056724
N-(5-bromo-2-chlorophenyl)-1-(propylamino)propane-2-sulfonamide (PubChem CID 106056724) has the molecular formula C12H18BrClN2O2S and a molecular weight of 369.71 g/mol. Its IUPAC name is N-(5-bromo-2-chlorophenyl)-1-(propylamino)propane-2-sulfonamide.
| Compound Name | N-(5-bromo-2-chlorophenyl)-1-(propylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106056724 |
| Molecular Formula | C12H18BrClN2O2S |
| Molecular Weight | 369.71 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | N-(5-bromo-2-chlorophenyl)-1-(propylamino)propane-2-sulfonamide |
| SMILES | CCCNCC(C)S(=O)(=O)Nc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C12H18BrClN2O2S/c1-3-6-15-8-9(2)19(17,18)16-12-7-10(13)4-5-11(12)14/h4-5,7,9,15-16H,3,6,8H2,1-2H3 |
| InChIKey | LJUAJDTVUAMCDI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|