C11H16BrClN2O2S — CID 62908956
N-(5-bromo-2-chlorophenyl)-2-(propan-2-ylamino)ethanesulfonamide (PubChem CID 62908956) has the molecular formula C11H16BrClN2O2S and a molecular weight of 355.69 g/mol. Its IUPAC name is N-(5-bromo-2-chlorophenyl)-2-(propan-2-ylamino)ethanesulfonamide.
| Compound Name | N-(5-bromo-2-chlorophenyl)-2-(propan-2-ylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 62908956 |
| Molecular Formula | C11H16BrClN2O2S |
| Molecular Weight | 355.69 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | N-(5-bromo-2-chlorophenyl)-2-(propan-2-ylamino)ethanesulfonamide |
| SMILES | CC(C)NCCS(=O)(=O)Nc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C11H16BrClN2O2S/c1-8(2)14-5-6-18(16,17)15-11-7-9(12)3-4-10(11)13/h3-4,7-8,14-15H,5-6H2,1-2H3 |
| InChIKey | AOTZMOSAQQLZTF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.69 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |