C10H12F4N2O2S — CID 106087564
1-(methylamino)-N-(2,3,5,6-tetrafluorophenyl)propane-2-sulfonamide (PubChem CID 106087564) has the molecular formula C10H12F4N2O2S and a molecular weight of 300.28 g/mol. Its IUPAC name is 1-(methylamino)-N-(2,3,5,6-tetrafluorophenyl)propane-2-sulfonamide.
| Compound Name | 1-(methylamino)-N-(2,3,5,6-tetrafluorophenyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106087564 |
| Molecular Formula | C10H12F4N2O2S |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-(methylamino)-N-(2,3,5,6-tetrafluorophenyl)propane-2-sulfonamide |
| SMILES | CNCC(C)S(=O)(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H12F4N2O2S/c1-5(4-15-2)19(17,18)16-10-8(13)6(11)3-7(12)9(10)14/h3,5,15-16H,4H2,1-2H3 |
| InChIKey | FWFARJNGVHPASD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|