C10H13Cl3N2O2S — CID 114136213
1-(methylamino)-N-(2,4,6-trichlorophenyl)propane-2-sulfonamide (PubChem CID 114136213) has the molecular formula C10H13Cl3N2O2S and a molecular weight of 331.65 g/mol. Its IUPAC name is 1-(methylamino)-N-(2,4,6-trichlorophenyl)propane-2-sulfonamide.
| Compound Name | 1-(methylamino)-N-(2,4,6-trichlorophenyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 114136213 |
| Molecular Formula | C10H13Cl3N2O2S |
| Molecular Weight | 331.65 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 1-(methylamino)-N-(2,4,6-trichlorophenyl)propane-2-sulfonamide |
| SMILES | CNCC(C)S(=O)(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl3N2O2S/c1-6(5-14-2)18(16,17)15-10-8(12)3-7(11)4-9(10)13/h3-4,6,14-15H,5H2,1-2H3 |
| InChIKey | PAUWAOXSXGUJHP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |