C10H11F5N2O2S — CID 106074521
1-(methylamino)-N-(2,3,4,5,6-pentafluorophenyl)propane-2-sulfonamide (PubChem CID 106074521) has the molecular formula C10H11F5N2O2S and a molecular weight of 318.27 g/mol. Its IUPAC name is 1-(methylamino)-N-(2,3,4,5,6-pentafluorophenyl)propane-2-sulfonamide.
| Compound Name | 1-(methylamino)-N-(2,3,4,5,6-pentafluorophenyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106074521 |
| Molecular Formula | C10H11F5N2O2S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-(methylamino)-N-(2,3,4,5,6-pentafluorophenyl)propane-2-sulfonamide |
| SMILES | CNCC(C)S(=O)(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H11F5N2O2S/c1-4(3-16-2)20(18,19)17-10-8(14)6(12)5(11)7(13)9(10)15/h4,16-17H,3H2,1-2H3 |
| InChIKey | ZBIHGLMXOGXKQT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|