C9H11F3N2O2S — CID 62809009
2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide (PubChem CID 62809009) has the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide.
| Compound Name | 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 62809009 |
| Molecular Formula | C9H11F3N2O2S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide |
| SMILES | CNCCS(=O)(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C9H11F3N2O2S/c1-13-2-3-17(15,16)14-9-5-7(11)6(10)4-8(9)12/h4-5,13-14H,2-3H2,1H3 |
| InChIKey | FJMFBBMKOCSUCA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|