About 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide
2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide (PubChem CID 62809009) has the molecular formula C9H11F3N2O2S
and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide.
Molecular Properties
| Compound Name | 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide |
| PubChem CID | 62809009 |
| Molecular Formula | C9H11F3N2O2S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide |
| SMILES | CNCCS(=O)(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C9H11F3N2O2S/c1-13-2-3-17(15,16)14-9-5-7(11)6(10)4-8(9)12/h4-5,13-14H,2-3H2,1H3 |
| InChIKey | FJMFBBMKOCSUCA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide?
The IUPAC name of 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide (CID 62809009) is 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide.
What is the SMILES notation for 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide?
The canonical SMILES for 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide is CNCCS(=O)(=O)Nc1cc(F)c(F)cc1F.
What is the InChIKey of 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide?
The InChIKey is FJMFBBMKOCSUCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O2S/c1-13-2-3-17(15,16)14-9-5-7(11)6(10)4-8(9)12/h4-5,13-14H,2-3H2,1H3.
What are the key properties of 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide?
2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide has a molecular weight of 268.26 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-N-(2,4,5-trifluorophenyl)ethanesulfonamide is sourced from PubChem (CID 62809009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).