C8H11ClN2 — CID 12589570
4-chloro-1-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 12589570) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 4-chloro-1-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 4-chloro-1-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 12589570 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 4-chloro-1-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CNc1ccc(Cl)cc1NC |
| InChI | InChI=1S/C8H11ClN2/c1-10-7-4-3-6(9)5-8(7)11-2/h3-5,10-11H,1-2H3 |
| InChIKey | BGCUFJNBWIABEB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |