C8H11F2N — CID 157160236
2,4-difluoro-N-methylaniline;methane (PubChem CID 157160236) has the molecular formula C8H11F2N and a molecular weight of 159.18 g/mol. Its IUPAC name is 2,4-difluoro-N-methylaniline;methane.
| Compound Name | 2,4-difluoro-N-methylaniline;methane |
|---|---|
| PubChem CID | 157160236 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 2,4-difluoro-N-methylaniline;methane |
| SMILES | C.CNc1ccc(F)cc1F |
| InChI | InChI=1S/C7H7F2N.CH4/c1-10-7-3-2-5(8)4-6(7)9;/h2-4,10H,1H3;1H4 |
| InChIKey | AMHCDMONZUBLNZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |