C11H13F2NO — CID 143382915
(E)-but-2-enal;2,4-difluoro-N-methylaniline (PubChem CID 143382915) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is (E)-but-2-enal;2,4-difluoro-N-methylaniline.
| Compound Name | (E)-but-2-enal;2,4-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 143382915 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (E)-but-2-enal;2,4-difluoro-N-methylaniline |
| SMILES | C/C=C/C=O.CNc1ccc(F)cc1F |
| InChI | InChI=1S/C7H7F2N.C4H6O/c1-10-7-3-2-5(8)4-6(7)9;1-2-3-4-5/h2-4,10H,1H3;2-4H,1H3/b;3-2+ |
| InChIKey | FJMBBCHIXFTBFR-ZPYUXNTASA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|