C11H12F2 — CID 167205018
1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene (PubChem CID 167205018) has the molecular formula C11H12F2 and a molecular weight of 182.21 g/mol. Its IUPAC name is 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene.
| Compound Name | 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene |
|---|---|
| PubChem CID | 167205018 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene |
| SMILES | C/C=C(/C)c1cc(F)c(F)cc1C |
| InChI | InChI=1S/C11H12F2/c1-4-7(2)9-6-11(13)10(12)5-8(9)3/h4-6H,1-3H3/b7-4- |
| InChIKey | HPJNZSFSTLTHNK-DAXSKMNVSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |