About 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene
1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene (PubChem CID 167205018) has the molecular formula C11H12F2
and a molecular weight of 182.21 g/mol. Its IUPAC name is 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene.
Molecular Properties
| Compound Name | 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene |
| PubChem CID | 167205018 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene |
| SMILES | C/C=C(/C)c1cc(F)c(F)cc1C |
| InChI | InChI=1S/C11H12F2/c1-4-7(2)9-6-11(13)10(12)5-8(9)3/h4-6H,1-3H3/b7-4- |
| InChIKey | HPJNZSFSTLTHNK-DAXSKMNVSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene?
The IUPAC name of 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene (CID 167205018) is 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene.
What is the SMILES notation for 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene?
The canonical SMILES for 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene is C/C=C(/C)c1cc(F)c(F)cc1C.
What is the InChIKey of 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene?
The InChIKey is HPJNZSFSTLTHNK-DAXSKMNVSA-N. The full InChI is InChI=1S/C11H12F2/c1-4-7(2)9-6-11(13)10(12)5-8(9)3/h4-6H,1-3H3/b7-4-.
What are the key properties of 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene?
1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene has a molecular weight of 182.21 g/mol, XLogP of 3.70, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-but-2-en-2-yl]-4,5-difluoro-2-methylbenzene is sourced from PubChem (CID 167205018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).