C15H22 — CID 143717580
1-[(Z)-but-2-en-2-yl]-2,4-dimethylbenzene;prop-1-ene (PubChem CID 143717580) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 1-[(Z)-but-2-en-2-yl]-2,4-dimethylbenzene;prop-1-ene.
| Compound Name | 1-[(Z)-but-2-en-2-yl]-2,4-dimethylbenzene;prop-1-ene |
|---|---|
| PubChem CID | 143717580 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-[(Z)-but-2-en-2-yl]-2,4-dimethylbenzene;prop-1-ene |
| SMILES | C/C=C(/C)c1ccc(C)cc1C.C=CC |
| InChI | InChI=1S/C12H16.C3H6/c1-5-10(3)12-7-6-9(2)8-11(12)4;1-3-2/h5-8H,1-4H3;3H,1H2,2H3/b10-5-; |
| InChIKey | APIDQUWJYMFXLF-WIMVAJRLSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|