About 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene
2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene (PubChem CID 168947702) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene.
Molecular Properties
| Compound Name | 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene |
| PubChem CID | 168947702 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene |
| SMILES | C=C/C=C(/C)c1ccc(C)cc1C |
| InChI | InChI=1S/C13H16/c1-5-6-11(3)13-8-7-10(2)9-12(13)4/h5-9H,1H2,2-4H3/b11-6- |
| InChIKey | NRNURBICWLMZQQ-WDZFZDKYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene?
The IUPAC name of 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene (CID 168947702) is 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene.
What is the SMILES notation for 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene?
The canonical SMILES for 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene is C=C/C=C(/C)c1ccc(C)cc1C.
What is the InChIKey of 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene?
The InChIKey is NRNURBICWLMZQQ-WDZFZDKYSA-N. The full InChI is InChI=1S/C13H16/c1-5-6-11(3)13-8-7-10(2)9-12(13)4/h5-9H,1H2,2-4H3/b11-6-.
What are the key properties of 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene?
2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene has a molecular weight of 172.27 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1-[(2Z)-penta-2,4-dien-2-yl]benzene is sourced from PubChem (CID 168947702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).