C21H23NOS — CID 144540011
N-[3-methyl-4-[(2E)-penta-2,4-dien-2-yl]phenyl]-2-(4-methylsulfanylphenyl)acetamide (PubChem CID 144540011) has the molecular formula C21H23NOS and a molecular weight of 337.49 g/mol. Its IUPAC name is N-[3-methyl-4-[(2E)-penta-2,4-dien-2-yl]phenyl]-2-(4-methylsulfanylphenyl)acetamide.
| Compound Name | N-[3-methyl-4-[(2E)-penta-2,4-dien-2-yl]phenyl]-2-(4-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 144540011 |
| Molecular Formula | C21H23NOS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[3-methyl-4-[(2E)-penta-2,4-dien-2-yl]phenyl]-2-(4-methylsulfanylphenyl)acetamide |
| SMILES | C=C/C=C(\C)c1ccc(NC(=O)Cc2ccc(SC)cc2)cc1C |
| InChI | InChI=1S/C21H23NOS/c1-5-6-15(2)20-12-9-18(13-16(20)3)22-21(23)14-17-7-10-19(24-4)11-8-17/h5-13H,1,14H2,2-4H3,(H,22,23)/b15-6+ |
| InChIKey | BLQPEAMNHWYXIL-GIDUJCDVSA-N |
| XLogP | 5.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|