C12H14FN — CID 143736258
4-fluoro-3-methyl-N-[(2E)-penta-2,4-dien-2-yl]aniline (PubChem CID 143736258) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[(2E)-penta-2,4-dien-2-yl]aniline.
| Compound Name | 4-fluoro-3-methyl-N-[(2E)-penta-2,4-dien-2-yl]aniline |
|---|---|
| PubChem CID | 143736258 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-fluoro-3-methyl-N-[(2E)-penta-2,4-dien-2-yl]aniline |
| SMILES | C=C/C=C(\C)Nc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C12H14FN/c1-4-5-10(3)14-11-6-7-12(13)9(2)8-11/h4-8,14H,1H2,2-3H3/b10-5+ |
| InChIKey | AMUBECKVRJHFES-BJMVGYQFSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|