C15H22FN — CID 143826394
ethane;3-fluoro-4-methyl-N-[(2E)-4-methylpenta-2,4-dien-2-yl]aniline (PubChem CID 143826394) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is ethane;3-fluoro-4-methyl-N-[(2E)-4-methylpenta-2,4-dien-2-yl]aniline.
| Compound Name | ethane;3-fluoro-4-methyl-N-[(2E)-4-methylpenta-2,4-dien-2-yl]aniline |
|---|---|
| PubChem CID | 143826394 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | ethane;3-fluoro-4-methyl-N-[(2E)-4-methylpenta-2,4-dien-2-yl]aniline |
| SMILES | C=C(C)/C=C(\C)Nc1ccc(C)c(F)c1.CC |
| InChI | InChI=1S/C13H16FN.C2H6/c1-9(2)7-11(4)15-12-6-5-10(3)13(14)8-12;1-2/h5-8,15H,1H2,2-4H3;1-2H3/b11-7+; |
| InChIKey | AUTMGRQAQKDNAC-RVDQCCQOSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|