C18H21FN2O2 — CID 143652874
N-(3-fluoro-4-methylphenyl)-N'-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]propanediamide (PubChem CID 143652874) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-N'-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]propanediamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-N'-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]propanediamide |
|---|---|
| PubChem CID | 143652874 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-N'-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]propanediamide |
| SMILES | C=C(C)/C(=C\C=C/C)NC(=O)CC(=O)Nc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C18H21FN2O2/c1-5-6-7-16(12(2)3)21-18(23)11-17(22)20-14-9-8-13(4)15(19)10-14/h5-10H,2,11H2,1,3-4H3,(H,20,22)(H,21,23)/b6-5-,16-7+ |
| InChIKey | SDDDVJMPJAYHTJ-DKPKDLPHSA-N |
| XLogP | 3.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|