C15H17N3S2 — CID 142915593
5-[(1E)-1-(2,4-dimethylphenyl)buta-1,3-dienyl]sulfanyl-N-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 142915593) has the molecular formula C15H17N3S2 and a molecular weight of 303.46 g/mol. Its IUPAC name is 5-[(1E)-1-(2,4-dimethylphenyl)buta-1,3-dienyl]sulfanyl-N-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(1E)-1-(2,4-dimethylphenyl)buta-1,3-dienyl]sulfanyl-N-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 142915593 |
| Molecular Formula | C15H17N3S2 |
| Molecular Weight | 303.46 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 5-[(1E)-1-(2,4-dimethylphenyl)buta-1,3-dienyl]sulfanyl-N-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=C/C=C(/Sc1nnc(NC)s1)c1ccc(C)cc1C |
| InChI | InChI=1S/C15H17N3S2/c1-5-6-13(12-8-7-10(2)9-11(12)3)19-15-18-17-14(16-4)20-15/h5-9H,1H2,2-4H3,(H,16,17)/b13-6+ |
| InChIKey | XAKKWKSEDJMCOY-AWNIVKPZSA-N |
| XLogP | 4.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|