C12H13O2S- — CID 146288783
(1E)-1-(2,4-dimethylphenyl)buta-1,3-diene-1-sulfinate (PubChem CID 146288783) has the molecular formula C12H13O2S- and a molecular weight of 221.30 g/mol. Its IUPAC name is (1E)-1-(2,4-dimethylphenyl)buta-1,3-diene-1-sulfinate.
| Compound Name | (1E)-1-(2,4-dimethylphenyl)buta-1,3-diene-1-sulfinate |
|---|---|
| PubChem CID | 146288783 |
| Molecular Formula | C12H13O2S- |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (1E)-1-(2,4-dimethylphenyl)buta-1,3-diene-1-sulfinate |
| SMILES | C=C/C=C(\c1ccc(C)cc1C)S(=O)[O-] |
| InChI | InChI=1S/C12H14O2S/c1-4-5-12(15(13)14)11-7-6-9(2)8-10(11)3/h4-8H,1H2,2-3H3,(H,13,14)/p-1/b12-5+ |
| InChIKey | SEEATUAMBMGKAT-LFYBBSHMSA-M |
| XLogP | 2.71 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|