C11H11FO — CID 11194655
1-(2,4-dimethylphenyl)-2-fluoroprop-2-en-1-one (PubChem CID 11194655) has the molecular formula C11H11FO and a molecular weight of 178.21 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-fluoroprop-2-en-1-one.
| Compound Name | 1-(2,4-dimethylphenyl)-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 11194655 |
| Molecular Formula | C11H11FO |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C11H11FO/c1-7-4-5-10(8(2)6-7)11(13)9(3)12/h4-6H,3H2,1-2H3 |
| InChIKey | DWMHVXKKASIVPU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|