2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid

C13H14O4 — CID 90311592

IUPAC2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid
SMILESCC(=C(C(=O)O)C(=O)O)c1ccc(C)cc1C
InChIInChI=1S/C13H14O4/c1-7-4-5-10(8(2)6-7)9(3)11(12(14)15)13(16)17/h4-6H,1-3H3,(H,14,15)(H,16,17)
InChIKeyYYRCIGFHNJFIIB-UHFFFAOYSA-N
MW234.25 g/mol
LogP2.25
Rot. Bonds3

About 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid

2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid (PubChem CID 90311592) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid.

Molecular Properties

Compound Name2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid
PubChem CID90311592
Molecular FormulaC13H14O4
Molecular Weight234.25 g/mol
Exact Mass234.09
IUPAC Name2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid
SMILESCC(=C(C(=O)O)C(=O)O)c1ccc(C)cc1C
InChIInChI=1S/C13H14O4/c1-7-4-5-10(8(2)6-7)9(3)11(12(14)15)13(16)17/h4-6H,1-3H3,(H,14,15)(H,16,17)
InChIKeyYYRCIGFHNJFIIB-UHFFFAOYSA-N
XLogP2.25
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.25
LogP ≤ 52.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}

Analyze 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid?
The IUPAC name of 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid (CID 90311592) is 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid.
What is the SMILES notation for 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid?
The canonical SMILES for 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid is CC(=C(C(=O)O)C(=O)O)c1ccc(C)cc1C.
What is the InChIKey of 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid?
The InChIKey is YYRCIGFHNJFIIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4/c1-7-4-5-10(8(2)6-7)9(3)11(12(14)15)13(16)17/h4-6H,1-3H3,(H,14,15)(H,16,17).
What are the key properties of 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid?
2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid has a molecular weight of 234.25 g/mol, XLogP of 2.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,4-dimethylphenyl)ethylidene]propanedioic acid is sourced from PubChem (CID 90311592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).