C14H18O3 — CID 79414229
4-(2,4-dimethylphenyl)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 79414229) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(2,4-dimethylphenyl)-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 79414229 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | Cc1ccc(C(=O)C(C)C(C)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C14H18O3/c1-8-5-6-12(9(2)7-8)13(15)10(3)11(4)14(16)17/h5-7,10-11H,1-4H3,(H,16,17) |
| InChIKey | AZNDFIUCKOALRY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |