C14H16O4S — CID 13476437
2-acetylsulfanyl-4-(2,4-dimethylphenyl)-4-oxobutanoic acid (PubChem CID 13476437) has the molecular formula C14H16O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-acetylsulfanyl-4-(2,4-dimethylphenyl)-4-oxobutanoic acid.
| Compound Name | 2-acetylsulfanyl-4-(2,4-dimethylphenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 13476437 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-acetylsulfanyl-4-(2,4-dimethylphenyl)-4-oxobutanoic acid |
| SMILES | CC(=O)SC(CC(=O)c1ccc(C)cc1C)C(=O)O |
| InChI | InChI=1S/C14H16O4S/c1-8-4-5-11(9(2)6-8)12(16)7-13(14(17)18)19-10(3)15/h4-6,13H,7H2,1-3H3,(H,17,18) |
| InChIKey | NFEWUUBJFXXKBQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|