C13H11F3O4S — CID 14116647
2-acetylsulfanyl-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 14116647) has the molecular formula C13H11F3O4S and a molecular weight of 320.29 g/mol. Its IUPAC name is 2-acetylsulfanyl-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 2-acetylsulfanyl-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 14116647 |
| Molecular Formula | C13H11F3O4S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-acetylsulfanyl-4-oxo-4-[3-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | CC(=O)SC(CC(=O)c1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C13H11F3O4S/c1-7(17)21-11(12(19)20)6-10(18)8-3-2-4-9(5-8)13(14,15)16/h2-5,11H,6H2,1H3,(H,19,20) |
| InChIKey | CDZOVUGKFLIHHJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|