C12H14O2 — CID 146991450
(1Z)-1-(2,4-dimethylphenyl)buta-1,3-diene-1,2-diol (PubChem CID 146991450) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (1Z)-1-(2,4-dimethylphenyl)buta-1,3-diene-1,2-diol.
| Compound Name | (1Z)-1-(2,4-dimethylphenyl)buta-1,3-diene-1,2-diol |
|---|---|
| PubChem CID | 146991450 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (1Z)-1-(2,4-dimethylphenyl)buta-1,3-diene-1,2-diol |
| SMILES | C=C/C(O)=C(/O)c1ccc(C)cc1C |
| InChI | InChI=1S/C12H14O2/c1-4-11(13)12(14)10-6-5-8(2)7-9(10)3/h4-7,13-14H,1H2,2-3H3/b12-11- |
| InChIKey | AQGSYTOCIYXVER-QXMHVHEDSA-N |
| XLogP | 3.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|