C26H31N — CID 145223761
5-[(3Z,5E,7E)-8-(2,4-dimethylphenyl)-5,6-dimethylnona-1,3,5,7-tetraen-4-yl]-2-methylaniline (PubChem CID 145223761) has the molecular formula C26H31N and a molecular weight of 357.54 g/mol. Its IUPAC name is 5-[(3Z,5E,7E)-8-(2,4-dimethylphenyl)-5,6-dimethylnona-1,3,5,7-tetraen-4-yl]-2-methylaniline.
| Compound Name | 5-[(3Z,5E,7E)-8-(2,4-dimethylphenyl)-5,6-dimethylnona-1,3,5,7-tetraen-4-yl]-2-methylaniline |
|---|---|
| PubChem CID | 145223761 |
| Molecular Formula | C26H31N |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 5-[(3Z,5E,7E)-8-(2,4-dimethylphenyl)-5,6-dimethylnona-1,3,5,7-tetraen-4-yl]-2-methylaniline |
| SMILES | C=C/C=C(C(\C)=C(C)\C=C(/C)c1ccc(C)cc1C)/c1ccc(C)c(N)c1 |
| InChI | InChI=1S/C26H31N/c1-8-9-25(23-12-11-18(3)26(27)16-23)22(7)19(4)15-21(6)24-13-10-17(2)14-20(24)5/h8-16H,1,27H2,2-7H3/b21-15+,22-19+,25-9+ |
| InChIKey | POQOCICPKXLRPT-QVOXUTPJSA-N |
| XLogP | 7.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|