C24H22N4 — CID 144915900
4-[3-[(1E)-1-(2,4-dimethylphenyl)buta-1,3-dienyl]pyrazolo[1,5-a]pyrimidin-6-yl]aniline (PubChem CID 144915900) has the molecular formula C24H22N4 and a molecular weight of 366.47 g/mol. Its IUPAC name is 4-[3-[(1E)-1-(2,4-dimethylphenyl)buta-1,3-dienyl]pyrazolo[1,5-a]pyrimidin-6-yl]aniline.
| Compound Name | 4-[3-[(1E)-1-(2,4-dimethylphenyl)buta-1,3-dienyl]pyrazolo[1,5-a]pyrimidin-6-yl]aniline |
|---|---|
| PubChem CID | 144915900 |
| Molecular Formula | C24H22N4 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-[3-[(1E)-1-(2,4-dimethylphenyl)buta-1,3-dienyl]pyrazolo[1,5-a]pyrimidin-6-yl]aniline |
| SMILES | C=C/C=C(\c1ccc(C)cc1C)c1cnn2cc(-c3ccc(N)cc3)cnc12 |
| InChI | InChI=1S/C24H22N4/c1-4-5-22(21-11-6-16(2)12-17(21)3)23-14-27-28-15-19(13-26-24(23)28)18-7-9-20(25)10-8-18/h4-15H,1,25H2,2-3H3/b22-5+ |
| InChIKey | SSBOYKIQADNRBI-RREIPUBJSA-N |
| XLogP | 5.21 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|