C13H14N2 — CID 144630318
5-methyl-3-[(2E)-penta-2,4-dien-2-yl]pyrazolo[1,5-a]pyridine (PubChem CID 144630318) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-methyl-3-[(2E)-penta-2,4-dien-2-yl]pyrazolo[1,5-a]pyridine.
| Compound Name | 5-methyl-3-[(2E)-penta-2,4-dien-2-yl]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 144630318 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 5-methyl-3-[(2E)-penta-2,4-dien-2-yl]pyrazolo[1,5-a]pyridine |
| SMILES | C=C/C=C(\C)c1cnn2ccc(C)cc12 |
| InChI | InChI=1S/C13H14N2/c1-4-5-11(3)12-9-14-15-7-6-10(2)8-13(12)15/h4-9H,1H2,2-3H3/b11-5+ |
| InChIKey | WYWVFSKWLAAQBL-VZUCSPMQSA-N |
| XLogP | 3.23 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|