C9H9BrN4 — CID 91514959
1-(5-bromopyrazolo[1,5-a]pyridin-3-yl)ethylidenehydrazine (PubChem CID 91514959) has the molecular formula C9H9BrN4 and a molecular weight of 253.10 g/mol. Its IUPAC name is 1-(5-bromopyrazolo[1,5-a]pyridin-3-yl)ethylidenehydrazine.
| Compound Name | 1-(5-bromopyrazolo[1,5-a]pyridin-3-yl)ethylidenehydrazine |
|---|---|
| PubChem CID | 91514959 |
| Molecular Formula | C9H9BrN4 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 1-(5-bromopyrazolo[1,5-a]pyridin-3-yl)ethylidenehydrazine |
| SMILES | CC(=NN)c1cnn2ccc(Br)cc12 |
| InChI | InChI=1S/C9H9BrN4/c1-6(13-11)8-5-12-14-3-2-7(10)4-9(8)14/h2-5H,11H2,1H3 |
| InChIKey | WMZVQWBMAOYSCT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|