C23H27F — CID 143621628
1-[(E)-but-2-en-2-yl]-5-[3-(3-fluorophenyl)propyl]-2-methyl-4-prop-1-en-2-ylbenzene (PubChem CID 143621628) has the molecular formula C23H27F and a molecular weight of 322.47 g/mol. Its IUPAC name is 1-[(E)-but-2-en-2-yl]-5-[3-(3-fluorophenyl)propyl]-2-methyl-4-prop-1-en-2-ylbenzene.
| Compound Name | 1-[(E)-but-2-en-2-yl]-5-[3-(3-fluorophenyl)propyl]-2-methyl-4-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 143621628 |
| Molecular Formula | C23H27F |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-[(E)-but-2-en-2-yl]-5-[3-(3-fluorophenyl)propyl]-2-methyl-4-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1cc(C)c(/C(C)=C/C)cc1CCCc1cccc(F)c1 |
| InChI | InChI=1S/C23H27F/c1-6-17(4)23-15-20(22(16(2)3)13-18(23)5)11-7-9-19-10-8-12-21(24)14-19/h6,8,10,12-15H,2,7,9,11H2,1,3-5H3/b17-6+ |
| InChIKey | LTYBZYNYEWQFAG-UBKPWBPPSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |