C27H39FO — CID 143621044
ethane;1-[3-(3-fluorophenyl)propyl]-4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-2-(propoxymethyl)benzene;molecular hydrogen (PubChem CID 143621044) has the molecular formula C27H39FO and a molecular weight of 398.61 g/mol. Its IUPAC name is ethane;1-[3-(3-fluorophenyl)propyl]-4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-2-(propoxymethyl)benzene;molecular hydrogen.
| Compound Name | ethane;1-[3-(3-fluorophenyl)propyl]-4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-2-(propoxymethyl)benzene;molecular hydrogen |
|---|---|
| PubChem CID | 143621044 |
| Molecular Formula | C27H39FO |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | ethane;1-[3-(3-fluorophenyl)propyl]-4-methyl-5-[(3E)-penta-1,3-dien-3-yl]-2-(propoxymethyl)benzene;molecular hydrogen |
| SMILES | C=C/C(=C\C)c1cc(CCCc2cccc(F)c2)c(COCCC)cc1C.CC.[H][H] |
| InChI | InChI=1S/C25H31FO.C2H6.H2/c1-5-14-27-18-23-15-19(4)25(21(6-2)7-3)17-22(23)12-8-10-20-11-9-13-24(26)16-20;1-2;/h6-7,9,11,13,15-17H,2,5,8,10,12,14,18H2,1,3-4H3;1-2H3;1H/b21-7+;; |
| InChIKey | AWUQGEMORAFCGC-HSBSZRBOSA-N |
| XLogP | 8.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|